C27H38N4O — CID 111394339
2-methyl-1-[[4-(2-methylphenyl)oxan-4-yl]methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111394339) has the molecular formula C27H38N4O and a molecular weight of 434.63 g/mol. Its IUPAC name is 2-methyl-1-[[4-(2-methylphenyl)oxan-4-yl]methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[[4-(2-methylphenyl)oxan-4-yl]methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111394339 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2-methyl-1-[[4-(2-methylphenyl)oxan-4-yl]methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(CN2CCCC2)cc1)NCC1(c2ccccc2C)CCOCC1 |
| InChI | InChI=1S/C27H38N4O/c1-22-7-3-4-8-25(22)27(13-17-32-18-14-27)21-30-26(28-2)29-19-23-9-11-24(12-10-23)20-31-15-5-6-16-31/h3-4,7-12H,5-6,13-21H2,1-2H3,(H2,28,29,30) |
| InChIKey | PRCRETFOPOOBOW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|