C18H27F3IN3OS — CID 111513815
1-ethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111513815) has the molecular formula C18H27F3IN3OS and a molecular weight of 517.40 g/mol. Its IUPAC name is 1-ethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111513815 |
| Molecular Formula | C18H27F3IN3OS |
| Molecular Weight | 517.40 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 1-ethyl-3-[(4-methylsulfanyloxan-4-yl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCC1(SC)CCOCC1.I |
| InChI | InChI=1S/C18H26F3N3OS.HI/c1-3-22-16(24-13-17(26-2)7-9-25-10-8-17)23-12-14-5-4-6-15(11-14)18(19,20)21;/h4-6,11H,3,7-10,12-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | FGWWQFOYGJOONX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|