C15H28IN5OS — CID 111690141
1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111690141) has the molecular formula C15H28IN5OS and a molecular weight of 453.39 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111690141 |
| Molecular Formula | C15H28IN5OS |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(4-methylsulfanyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCC1(SC)CCOCC1.I |
| InChI | InChI=1S/C15H27N5OS.HI/c1-4-16-14(17-11-13-5-8-19-20(13)2)18-12-15(22-3)6-9-21-10-7-15;/h5,8H,4,6-7,9-12H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | YQNQRUNGNJCAMT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|