C18H30ClIN4OS2 — CID 111516988
4-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111516988) has the molecular formula C18H30ClIN4OS2 and a molecular weight of 544.96 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111516988 |
| Molecular Formula | C18H30ClIN4OS2 |
| Molecular Weight | 544.96 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)N1CCN(Cc2ccc(Cl)s2)CC1.I |
| InChI | InChI=1S/C18H29ClN4OS2.HI/c1-20-17(21-14-18(25-2)5-11-24-12-6-18)23-9-7-22(8-10-23)13-15-3-4-16(19)26-15;/h3-4H,5-14H2,1-2H3,(H,20,21);1H |
| InChIKey | WBCPLFDIGLYMNE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.96 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|