C17H29ClIN5OS — CID 111358853
N-[2-[[C-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111358853) has the molecular formula C17H29ClIN5OS and a molecular weight of 513.88 g/mol. Its IUPAC name is N-[2-[[C-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[C-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111358853 |
| Molecular Formula | C17H29ClIN5OS |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | N-[2-[[C-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)N1CCN(Cc2ccc(Cl)s2)CC1.I |
| InChI | InChI=1S/C17H28ClN5OS.HI/c1-13(2)16(24)20-6-7-21-17(19-3)23-10-8-22(9-11-23)12-14-4-5-15(18)25-14;/h4-5,13H,6-12H2,1-3H3,(H,19,21)(H,20,24);1H |
| InChIKey | MGBXODQIQLKGMG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|