C14H21ClN2O2S — CID 79204548
1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-hydroxypentan-1-one (PubChem CID 79204548) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-hydroxypentan-1-one.
| Compound Name | 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-hydroxypentan-1-one |
|---|---|
| PubChem CID | 79204548 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-4-hydroxypentan-1-one |
| SMILES | CC(O)CCC(=O)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C14H21ClN2O2S/c1-11(18)2-5-14(19)17-8-6-16(7-9-17)10-12-3-4-13(15)20-12/h3-4,11,18H,2,5-10H2,1H3 |
| InChIKey | MVEJEYLGPYFMFO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |