C13H18BrClN2OS — CID 62854509
2-bromo-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one (PubChem CID 62854509) has the molecular formula C13H18BrClN2OS and a molecular weight of 365.72 g/mol. Its IUPAC name is 2-bromo-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 2-bromo-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 62854509 |
| Molecular Formula | C13H18BrClN2OS |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 2-bromo-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one |
| SMILES | CCC(Br)C(=O)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H18BrClN2OS/c1-2-11(14)13(18)17-7-5-16(6-8-17)9-10-3-4-12(15)19-10/h3-4,11H,2,5-9H2,1H3 |
| InChIKey | XLVIOQUHOWTICJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|