C14H22ClN3OS — CID 65230256
2-(aminomethyl)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one (PubChem CID 65230256) has the molecular formula C14H22ClN3OS and a molecular weight of 315.87 g/mol. Its IUPAC name is 2-(aminomethyl)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 2-(aminomethyl)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 65230256 |
| Molecular Formula | C14H22ClN3OS |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-(aminomethyl)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]butan-1-one |
| SMILES | CCC(CN)C(=O)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C14H22ClN3OS/c1-2-11(9-16)14(19)18-7-5-17(6-8-18)10-12-3-4-13(15)20-12/h3-4,11H,2,5-10,16H2,1H3 |
| InChIKey | MZDORMVPZOUWFR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |