C15H24ClN3OS — CID 104684302
5-amino-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-methylpentan-1-one (PubChem CID 104684302) has the molecular formula C15H24ClN3OS and a molecular weight of 329.90 g/mol. Its IUPAC name is 5-amino-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-methylpentan-1-one.
| Compound Name | 5-amino-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-methylpentan-1-one |
|---|---|
| PubChem CID | 104684302 |
| Molecular Formula | C15H24ClN3OS |
| Molecular Weight | 329.90 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 5-amino-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-methylpentan-1-one |
| SMILES | CC(CCCN)C(=O)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H24ClN3OS/c1-12(3-2-6-17)15(20)19-9-7-18(8-10-19)11-13-4-5-14(16)21-13/h4-5,12H,2-3,6-11,17H2,1H3 |
| InChIKey | XTQDJTNKKGNJFN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.90 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |