C15H19ClN4OS — CID 94020478
(2R)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-imidazol-1-ylpropan-1-one (PubChem CID 94020478) has the molecular formula C15H19ClN4OS and a molecular weight of 338.86 g/mol. Its IUPAC name is (2R)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-imidazol-1-ylpropan-1-one.
| Compound Name | (2R)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-imidazol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 94020478 |
| Molecular Formula | C15H19ClN4OS |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2R)-1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-imidazol-1-ylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCN(Cc2ccc(Cl)s2)CC1)n1ccnc1 |
| InChI | InChI=1S/C15H19ClN4OS/c1-12(20-5-4-17-11-20)15(21)19-8-6-18(7-9-19)10-13-2-3-14(16)22-13/h2-5,11-12H,6-10H2,1H3/t12-/m1/s1 |
| InChIKey | WGOSNWYHNVMCPX-GFCCVEGCSA-N |
| XLogP | 2.50 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |