C20H33IN4OS — CID 111493455
N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111493455) has the molecular formula C20H33IN4OS and a molecular weight of 504.48 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111493455 |
| Molecular Formula | C20H33IN4OS |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C20H32N4OS.HI/c1-3-21-19(22-17-20(26-2)9-15-25-16-10-20)24-13-11-23(12-14-24)18-7-5-4-6-8-18;/h4-8H,3,9-17H2,1-2H3,(H,21,22);1H |
| InChIKey | JJQKQOWAEBYZRU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|