C22H37IN4OS — CID 111513117
4-(2,3-dimethylphenyl)-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111513117) has the molecular formula C22H37IN4OS and a molecular weight of 532.54 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111513117 |
| Molecular Formula | C22H37IN4OS |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)N1CCN(c2cccc(C)c2C)CC1.I |
| InChI | InChI=1S/C22H36N4OS.HI/c1-5-23-21(24-17-22(28-4)9-15-27-16-10-22)26-13-11-25(12-14-26)20-8-6-7-18(2)19(20)3;/h6-8H,5,9-17H2,1-4H3,(H,23,24);1H |
| InChIKey | GJIPWDAVERITLY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|