C17H33IN4O3S — CID 111511282
ethyl 4-[N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111511282) has the molecular formula C17H33IN4O3S and a molecular weight of 500.45 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111511282 |
| Molecular Formula | C17H33IN4O3S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C17H32N4O3S.HI/c1-4-18-15(19-14-17(25-3)6-12-23-13-7-17)20-8-10-21(11-9-20)16(22)24-5-2;/h4-14H2,1-3H3,(H,18,19);1H |
| InChIKey | OLHCLFNGXBHYMQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|