C22H33N3OS — CID 109414345
4-benzylidene-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide (PubChem CID 109414345) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 4-benzylidene-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzylidene-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109414345 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 4-benzylidene-N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H33N3OS/c1-3-23-21(24-18-22(27-2)11-15-26-16-12-22)25-13-9-20(10-14-25)17-19-7-5-4-6-8-19/h4-8,17H,3,9-16,18H2,1-2H3,(H,23,24) |
| InChIKey | MPBIRALDHNVHGR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|