C18H33N3OS — CID 109441819
N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109441819) has the molecular formula C18H33N3OS and a molecular weight of 339.55 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109441819 |
| Molecular Formula | C18H33N3OS |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | N-ethyl-N'-[(4-methylsulfanyloxan-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C18H33N3OS/c1-3-19-17(20-14-18(23-2)8-10-22-11-9-18)21-12-15-6-4-5-7-16(15)13-21/h15-16H,3-14H2,1-2H3,(H,19,20) |
| InChIKey | HDJSQEPFDYALSS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|