C19H35N3OS — CID 119157386
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine (PubChem CID 119157386) has the molecular formula C19H35N3OS and a molecular weight of 353.58 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119157386 |
| Molecular Formula | C19H35N3OS |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)NC1CCC2CCCC2C1 |
| InChI | InChI=1S/C19H35N3OS/c1-3-20-18(21-14-19(24-2)9-11-23-12-10-19)22-17-8-7-15-5-4-6-16(15)13-17/h15-17H,3-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | IWVPSHPNGZDGAC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|