C18H34IN3O — CID 119134195
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-ethyl-2-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 119134195) has the molecular formula C18H34IN3O and a molecular weight of 435.39 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-ethyl-2-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-ethyl-2-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119134195 |
| Molecular Formula | C18H34IN3O |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-ethyl-2-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCOC1)NC1CCC2CCCCC2C1.I |
| InChI | InChI=1S/C18H33N3O.HI/c1-2-19-18(20-12-14-9-10-22-13-14)21-17-8-7-15-5-3-4-6-16(15)11-17;/h14-17H,2-13H2,1H3,(H2,19,20,21);1H |
| InChIKey | PDOUZFPJWRJYEM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|