C19H35N3O2S — CID 119146251
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-propylguanidine (PubChem CID 119146251) has the molecular formula C19H35N3O2S and a molecular weight of 369.58 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-propylguanidine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-propylguanidine |
|---|---|
| PubChem CID | 119146251 |
| Molecular Formula | C19H35N3O2S |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-propylguanidine |
| SMILES | CCCN/C(=N\CC1CCS(=O)(=O)C1)NC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C19H35N3O2S/c1-2-10-20-19(21-13-15-9-11-25(23,24)14-15)22-18-8-7-16-5-3-4-6-17(16)12-18/h15-18H,2-14H2,1H3,(H2,20,21,22) |
| InChIKey | NKEJPHOCSIRDPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|