C16H25N3O2S — CID 111134387
2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(2-phenylethyl)guanidine (PubChem CID 111134387) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(2-phenylethyl)guanidine.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111134387 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(2-phenylethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCc1ccccc1 |
| InChI | InChI=1S/C16H25N3O2S/c1-2-17-16(18-10-8-14-6-4-3-5-7-14)19-12-15-9-11-22(20,21)13-15/h3-7,15H,2,8-13H2,1H3,(H2,17,18,19) |
| InChIKey | GPUDTDBMEKWMDO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|