C17H28IN3O3S — CID 111277360
2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111277360) has the molecular formula C17H28IN3O3S and a molecular weight of 481.40 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111277360 |
| Molecular Formula | C17H28IN3O3S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(4-methylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCOc1ccc(C)cc1.I |
| InChI | InChI=1S/C17H27N3O3S.HI/c1-3-18-17(20-12-15-8-11-24(21,22)13-15)19-9-10-23-16-6-4-14(2)5-7-16;/h4-7,15H,3,8-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | VOMLCVFLZCFXQO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|