C17H27FIN3O2S2 — CID 111311313
2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide (PubChem CID 111311313) has the molecular formula C17H27FIN3O2S2 and a molecular weight of 515.46 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111311313 |
| Molecular Formula | C17H27FIN3O2S2 |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCCSc1ccc(F)cc1.I |
| InChI | InChI=1S/C17H26FN3O2S2.HI/c1-2-19-17(21-12-14-8-11-25(22,23)13-14)20-9-3-10-24-16-6-4-15(18)5-7-16;/h4-7,14H,2-3,8-13H2,1H3,(H2,19,20,21);1H |
| InChIKey | CRMUEAWQAOQXGE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|