C19H33IN4O2S — CID 111390118
2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(N-ethylanilino)propyl]guanidine;hydroiodide (PubChem CID 111390118) has the molecular formula C19H33IN4O2S and a molecular weight of 508.47 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(N-ethylanilino)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(N-ethylanilino)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111390118 |
| Molecular Formula | C19H33IN4O2S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[3-(N-ethylanilino)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCCN(CC)c1ccccc1.I |
| InChI | InChI=1S/C19H32N4O2S.HI/c1-3-20-19(22-15-17-11-14-26(24,25)16-17)21-12-8-13-23(4-2)18-9-6-5-7-10-18;/h5-7,9-10,17H,3-4,8,11-16H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | IZMLIVQAXAJBTR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|