C17H36N4O2S — CID 111691280
2-[(1,1-dioxothiolan-3-yl)methyl]-1-[3-[di(propan-2-yl)amino]propyl]-3-ethylguanidine (PubChem CID 111691280) has the molecular formula C17H36N4O2S and a molecular weight of 360.57 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-[3-[di(propan-2-yl)amino]propyl]-3-ethylguanidine.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-[3-[di(propan-2-yl)amino]propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111691280 |
| Molecular Formula | C17H36N4O2S |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-[3-[di(propan-2-yl)amino]propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C17H36N4O2S/c1-6-18-17(20-12-16-8-11-24(22,23)13-16)19-9-7-10-21(14(2)3)15(4)5/h14-16H,6-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | NJCNBXOVRIWTJC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|