C17H35IN4O2S — CID 111325169
1-[3-(azepan-1-yl)propyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111325169) has the molecular formula C17H35IN4O2S and a molecular weight of 486.46 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111325169 |
| Molecular Formula | C17H35IN4O2S |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCCN1CCCCCC1.I |
| InChI | InChI=1S/C17H34N4O2S.HI/c1-2-18-17(20-14-16-8-13-24(22,23)15-16)19-9-7-12-21-10-5-3-4-6-11-21;/h16H,2-15H2,1H3,(H2,18,19,20);1H |
| InChIKey | XOKAHIHYOKWOCX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|