C19H28N4O2S — CID 111341507
2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine (PubChem CID 111341507) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111341507 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C19H28N4O2S/c1-2-20-19(22-14-16-9-13-26(24,25)15-16)21-10-5-11-23-12-8-17-6-3-4-7-18(17)23/h3-4,6-8,12,16H,2,5,9-11,13-15H2,1H3,(H2,20,21,22) |
| InChIKey | SYDHZEBSXMRPPS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|