C18H27IN4O2S — CID 111141216
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111141216) has the molecular formula C18H27IN4O2S and a molecular weight of 490.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141216 |
| Molecular Formula | C18H27IN4O2S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-indol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1ccc2ccccc21)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H26N4O2S.HI/c1-2-19-18(21-16-9-13-25(23,24)14-16)20-10-5-11-22-12-8-15-6-3-4-7-17(15)22;/h3-4,6-8,12,16H,2,5,9-11,13-14H2,1H3,(H2,19,20,21);1H |
| InChIKey | UYSRCKACFQYKBD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|