C17H26IN5O2S — CID 111142752
2-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111142752) has the molecular formula C17H26IN5O2S and a molecular weight of 491.40 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111142752 |
| Molecular Formula | C17H26IN5O2S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1cnc2ccccc21)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H25N5O2S.HI/c1-2-18-17(21-14-8-11-25(23,24)12-14)19-9-5-10-22-13-20-15-6-3-4-7-16(15)22;/h3-4,6-7,13-14H,2,5,8-12H2,1H3,(H2,18,19,21);1H |
| InChIKey | WNZGEXOFRXPRSC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|