C16H25FIN3O3S — CID 111142456
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-(4-fluorophenoxy)propyl]guanidine;hydroiodide (PubChem CID 111142456) has the molecular formula C16H25FIN3O3S and a molecular weight of 485.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-(4-fluorophenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-(4-fluorophenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111142456 |
| Molecular Formula | C16H25FIN3O3S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-(4-fluorophenoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOc1ccc(F)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H24FN3O3S.HI/c1-2-18-16(20-14-8-11-24(21,22)12-14)19-9-3-10-23-15-6-4-13(17)5-7-15;/h4-7,14H,2-3,8-12H2,1H3,(H2,18,19,20);1H |
| InChIKey | GARUBRAEJKHUOI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|