C17H24FIN4O2S — CID 111787958
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111787958) has the molecular formula C17H24FIN4O2S and a molecular weight of 494.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111787958 |
| Molecular Formula | C17H24FIN4O2S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccc(F)cc12)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H23FN4O2S.HI/c1-2-19-17(22-14-6-8-25(23,24)11-14)20-7-5-12-10-21-16-4-3-13(18)9-15(12)16;/h3-4,9-10,14,21H,2,5-8,11H2,1H3,(H2,19,20,22);1H |
| InChIKey | UWJFTXVAVGKHPG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|