C21H33FIN5 — CID 111316663
1-ethyl-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111316663) has the molecular formula C21H33FIN5 and a molecular weight of 501.43 g/mol. Its IUPAC name is 1-ethyl-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111316663 |
| Molecular Formula | C21H33FIN5 |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 1-ethyl-2-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-propan-2-ylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c[nH]c2cc(F)ccc12)NC1CCN(C(C)C)CC1.I |
| InChI | InChI=1S/C21H32FN5.HI/c1-4-23-21(26-18-8-11-27(12-9-18)15(2)3)24-10-7-16-14-25-20-13-17(22)5-6-19(16)20;/h5-6,13-15,18,25H,4,7-12H2,1-3H3,(H2,23,24,26);1H |
| InChIKey | LFWLCOLDSDARQF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|