C19H29N5O — CID 111189338
2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine (PubChem CID 111189338) has the molecular formula C19H29N5O and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine.
| Compound Name | 2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
|---|---|
| PubChem CID | 111189338 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
| SMILES | CCN/C(=N\CCCn1cnc2ccccc21)NC1CCC(O)CC1 |
| InChI | InChI=1S/C19H29N5O/c1-2-20-19(23-15-8-10-16(25)11-9-15)21-12-5-13-24-14-22-17-6-3-4-7-18(17)24/h3-4,6-7,14-16,25H,2,5,8-13H2,1H3,(H2,20,21,23) |
| InChIKey | STRGOROXYJGYJA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|