C19H29N5O — CID 111341271
3-[[ethylamino-(3-indol-1-ylpropylamino)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 111341271) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 3-[[ethylamino-(3-indol-1-ylpropylamino)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[ethylamino-(3-indol-1-ylpropylamino)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111341271 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 3-[[ethylamino-(3-indol-1-ylpropylamino)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C19H29N5O/c1-4-21-18(23-14-19(2,3)17(20)25)22-11-7-12-24-13-10-15-8-5-6-9-16(15)24/h5-6,8-10,13H,4,7,11-12,14H2,1-3H3,(H2,20,25)(H2,21,22,23) |
| InChIKey | CQJZJVQPAOHBCI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|