C15H31N3O2S — CID 111204110
2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine (PubChem CID 111204110) has the molecular formula C15H31N3O2S and a molecular weight of 317.50 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine |
|---|---|
| PubChem CID | 111204110 |
| Molecular Formula | C15H31N3O2S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-(5-methylhexan-2-yl)guanidine |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NC(C)CCC(C)C |
| InChI | InChI=1S/C15H31N3O2S/c1-5-16-15(18-13(4)7-6-12(2)3)17-10-14-8-9-21(19,20)11-14/h12-14H,5-11H2,1-4H3,(H2,16,17,18) |
| InChIKey | JTUVFMZYEOYGQQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|