C20H38IN3O2S — CID 119146127
1-(cyclohexylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-methylcyclohexyl)guanidine;hydroiodide (PubChem CID 119146127) has the molecular formula C20H38IN3O2S and a molecular weight of 511.51 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-methylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 1-(cyclohexylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-methylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119146127 |
| Molecular Formula | C20H38IN3O2S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 1-(cyclohexylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-methylcyclohexyl)guanidine;hydroiodide |
| SMILES | CC1CCCCC1N/C(=N/CC1CCS(=O)(=O)C1)NCC1CCCCC1.I |
| InChI | InChI=1S/C20H37N3O2S.HI/c1-16-7-5-6-10-19(16)23-20(21-13-17-8-3-2-4-9-17)22-14-18-11-12-26(24,25)15-18;/h16-19H,2-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | FFSYETUABBMNLI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|