C11H21N3O2S — CID 119118287
1-(cyclobutylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]guanidine (PubChem CID 119118287) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119118287 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[(1,1-dioxothiolan-3-yl)methyl]guanidine |
| SMILES | N/C(=N\CC1CCS(=O)(=O)C1)NCC1CCC1 |
| InChI | InChI=1S/C11H21N3O2S/c12-11(13-6-9-2-1-3-9)14-7-10-4-5-17(15,16)8-10/h9-10H,1-8H2,(H3,12,13,14) |
| InChIKey | GJVLOGBLMAZQPR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|