C15H32IN3O2S — CID 109468034
2-[(1,1-dioxothian-4-yl)methyl]-1-octylguanidine;hydroiodide (PubChem CID 109468034) has the molecular formula C15H32IN3O2S and a molecular weight of 445.41 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)methyl]-1-octylguanidine;hydroiodide.
| Compound Name | 2-[(1,1-dioxothian-4-yl)methyl]-1-octylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109468034 |
| Molecular Formula | C15H32IN3O2S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)methyl]-1-octylguanidine;hydroiodide |
| SMILES | CCCCCCCCN/C(N)=N/CC1CCS(=O)(=O)CC1.I |
| InChI | InChI=1S/C15H31N3O2S.HI/c1-2-3-4-5-6-7-10-17-15(16)18-13-14-8-11-21(19,20)12-9-14;/h14H,2-13H2,1H3,(H3,16,17,18);1H |
| InChIKey | YUWVTWCHOSFZTP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|