C13H29N3O3S — CID 24879509
2-(cyclopropylmethyl)-1-heptylguanidine;methanesulfonic acid (PubChem CID 24879509) has the molecular formula C13H29N3O3S and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-1-heptylguanidine;methanesulfonic acid.
| Compound Name | 2-(cyclopropylmethyl)-1-heptylguanidine;methanesulfonic acid |
|---|---|
| PubChem CID | 24879509 |
| Molecular Formula | C13H29N3O3S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-(cyclopropylmethyl)-1-heptylguanidine;methanesulfonic acid |
| SMILES | CCCCCCCN/C(N)=N/CC1CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C12H25N3.CH4O3S/c1-2-3-4-5-6-9-14-12(13)15-10-11-7-8-11;1-5(2,3)4/h11H,2-10H2,1H3,(H3,13,14,15);1H3,(H,2,3,4) |
| InChIKey | CHFNOBDQRZQVLE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|