C31H66N8 — CID 143412154
1-[3-[7-[3-[[N'-(cycloheptylmethyl)carbamimidoyl]amino]propylamino]heptylamino]propyl]-2-(2-methylheptyl)guanidine (PubChem CID 143412154) has the molecular formula C31H66N8 and a molecular weight of 550.93 g/mol. Its IUPAC name is 1-[3-[7-[3-[[N'-(cycloheptylmethyl)carbamimidoyl]amino]propylamino]heptylamino]propyl]-2-(2-methylheptyl)guanidine.
| Compound Name | 1-[3-[7-[3-[[N'-(cycloheptylmethyl)carbamimidoyl]amino]propylamino]heptylamino]propyl]-2-(2-methylheptyl)guanidine |
|---|---|
| PubChem CID | 143412154 |
| Molecular Formula | C31H66N8 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.54 |
| IUPAC Name | 1-[3-[7-[3-[[N'-(cycloheptylmethyl)carbamimidoyl]amino]propylamino]heptylamino]propyl]-2-(2-methylheptyl)guanidine |
| SMILES | CCCCCC(C)C/N=C(\N)NCCCNCCCCCCCNCCCN/C(N)=N/CC1CCCCCC1 |
| InChI | InChI=1S/C31H66N8/c1-3-4-10-17-28(2)26-38-30(32)36-24-15-22-34-20-13-8-5-9-14-21-35-23-16-25-37-31(33)39-27-29-18-11-6-7-12-19-29/h28-29,34-35H,3-27H2,1-2H3,(H3,32,36,38)(H3,33,37,39) |
| InChIKey | XOMDMIUDKSOTER-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|