C17H34N4 — CID 10589924
2-(cyclohexylmethyl)-1-(5-pyrrolidin-1-ylpentyl)guanidine (PubChem CID 10589924) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-1-(5-pyrrolidin-1-ylpentyl)guanidine.
| Compound Name | 2-(cyclohexylmethyl)-1-(5-pyrrolidin-1-ylpentyl)guanidine |
|---|---|
| PubChem CID | 10589924 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 2-(cyclohexylmethyl)-1-(5-pyrrolidin-1-ylpentyl)guanidine |
| SMILES | N/C(=N\CC1CCCCC1)NCCCCCN1CCCC1 |
| InChI | InChI=1S/C17H34N4/c18-17(20-15-16-9-3-1-4-10-16)19-11-5-2-6-12-21-13-7-8-14-21/h16H,1-15H2,(H3,18,19,20) |
| InChIKey | RBGVDMBCRCCVQD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|