About 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride
2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride (PubChem CID 22500553) has the molecular formula C24H46Cl2N4
and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride |
| PubChem CID | 22500553 |
| Molecular Formula | C24H46Cl2N4 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\CC12CC3CC(CC(C3)C1)C2)NCCCCCN1CCCCCCC1 |
| InChI | InChI=1S/C24H44N4.2ClH/c25-23(26-9-5-4-8-12-28-10-6-2-1-3-7-11-28)27-19-24-16-20-13-21(17-24)15-22(14-20)18-24;;/h20-22H,1-19H2,(H3,25,26,27);2*1H |
| InChIKey | WMDDYXXWNZGEFM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride?
The IUPAC name of 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride (CID 22500553) is 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride.
What is the SMILES notation for 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride?
The canonical SMILES for 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride is Cl.Cl.N/C(=N\CC12CC3CC(CC(C3)C1)C2)NCCCCCN1CCCCCCC1.
What is the InChIKey of 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride?
The InChIKey is WMDDYXXWNZGEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44N4.2ClH/c25-23(26-9-5-4-8-12-28-10-6-2-1-3-7-11-28)27-19-24-16-20-13-21(17-24)15-22(14-20)18-24;;/h20-22H,1-19H2,(H3,25,26,27);2*1H.
What are the key properties of 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride?
2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride has a molecular weight of 461.57 g/mol, XLogP of 5.39, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantylmethyl)-1-[5-(azocan-1-yl)pentyl]guanidine;dihydrochloride is sourced from PubChem (CID 22500553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).