C41H82N14O — CID 155523273
1,1,3-tris[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3-[6-(diaminomethylideneamino)hexyl]urea (PubChem CID 155523273) has the molecular formula C41H82N14O and a molecular weight of 787.20 g/mol. Its IUPAC name is 1,1,3-tris[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3-[6-(diaminomethylideneamino)hexyl]urea.
| Compound Name | 1,1,3-tris[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3-[6-(diaminomethylideneamino)hexyl]urea |
|---|---|
| PubChem CID | 155523273 |
| Molecular Formula | C41H82N14O |
| Molecular Weight | 787.20 g/mol |
| Exact Mass | 786.68 |
| IUPAC Name | 1,1,3-tris[6-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]hexyl]-3-[6-(diaminomethylideneamino)hexyl]urea |
| SMILES | NC(N)=NCCCCCCN(CCCCCCN/C(N)=N/CC1CC1)C(=O)N(CCCCCCN/C(N)=N/CC1CC1)CCCCCCN/C(N)=N/CC1CC1 |
| InChI | InChI=1S/C41H82N14O/c42-37(43)47-23-9-1-5-13-27-54(28-14-6-2-10-24-48-38(44)51-31-34-17-18-34)41(56)55(29-15-7-3-11-25-49-39(45)52-32-35-19-20-35)30-16-8-4-12-26-50-40(46)53-33-36-21-22-36/h34-36H,1-33H2,(H4,42,43,47)(H3,44,48,51)(H3,45,49,52)(H3,46,50,53) |
| InChIKey | KZJRHPNGXKTHJK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 239.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|