C23H45N7O — CID 44597279
1-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-2-(cyclopropylmethyl)guanidine (PubChem CID 44597279) has the molecular formula C23H45N7O and a molecular weight of 435.66 g/mol. Its IUPAC name is 1-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-2-(cyclopropylmethyl)guanidine.
| Compound Name | 1-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-2-(cyclopropylmethyl)guanidine |
|---|---|
| PubChem CID | 44597279 |
| Molecular Formula | C23H45N7O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.37 |
| IUPAC Name | 1-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]-2-(cyclopropylmethyl)guanidine |
| SMILES | N/C1=N/CCCCCCCCN(CCCCCCCCN/C(N)=N/CC2CC2)C(=O)N1 |
| InChI | InChI=1S/C23H45N7O/c24-21(28-19-20-13-14-20)26-15-9-5-1-3-7-11-17-30-18-12-8-4-2-6-10-16-27-22(25)29-23(30)31/h20H,1-19H2,(H3,24,26,28)(H3,25,27,29,31) |
| InChIKey | HCDTZIJVNOVZON-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|