C53H104N14O — CID 155521962
1,1,3,3-tetrakis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea (PubChem CID 155521962) has the molecular formula C53H104N14O and a molecular weight of 953.51 g/mol. Its IUPAC name is 1,1,3,3-tetrakis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea.
| Compound Name | 1,1,3,3-tetrakis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea |
|---|---|
| PubChem CID | 155521962 |
| Molecular Formula | C53H104N14O |
| Molecular Weight | 953.51 g/mol |
| Exact Mass | 952.85 |
| IUPAC Name | 1,1,3,3-tetrakis[8-[[N'-(cyclopropylmethyl)carbamimidoyl]amino]octyl]urea |
| SMILES | N/C(=N\CC1CC1)NCCCCCCCCN(CCCCCCCCN/C(N)=N/CC1CC1)C(=O)N(CCCCCCCCN/C(N)=N/CC1CC1)CCCCCCCCN/C(N)=N/CC1CC1 |
| InChI | InChI=1S/C53H104N14O/c54-49(62-41-45-25-26-45)58-33-17-9-1-5-13-21-37-66(38-22-14-6-2-10-18-34-59-50(55)63-42-46-27-28-46)53(68)67(39-23-15-7-3-11-19-35-60-51(56)64-43-47-29-30-47)40-24-16-8-4-12-20-36-61-52(57)65-44-48-31-32-48/h45-48H,1-44H2,(H3,54,58,62)(H3,55,59,63)(H3,56,60,64)(H3,57,61,65) |
| InChIKey | WGAZVSXRGKNVLG-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 225.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.51 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|