C39H84N14O — CID 155537328
1,3-bis[8-(diaminomethylideneamino)octyl]-1,3-bis[8-[(N'-methylcarbamimidoyl)amino]octyl]urea (PubChem CID 155537328) has the molecular formula C39H84N14O and a molecular weight of 765.20 g/mol. Its IUPAC name is 1,3-bis[8-(diaminomethylideneamino)octyl]-1,3-bis[8-[(N'-methylcarbamimidoyl)amino]octyl]urea.
| Compound Name | 1,3-bis[8-(diaminomethylideneamino)octyl]-1,3-bis[8-[(N'-methylcarbamimidoyl)amino]octyl]urea |
|---|---|
| PubChem CID | 155537328 |
| Molecular Formula | C39H84N14O |
| Molecular Weight | 765.20 g/mol |
| Exact Mass | 764.70 |
| IUPAC Name | 1,3-bis[8-(diaminomethylideneamino)octyl]-1,3-bis[8-[(N'-methylcarbamimidoyl)amino]octyl]urea |
| SMILES | C/N=C(\N)NCCCCCCCCN(CCCCCCCCN=C(N)N)C(=O)N(CCCCCCCCN=C(N)N)CCCCCCCCN/C(N)=N/C |
| InChI | InChI=1S/C39H84N14O/c1-46-37(44)50-29-21-13-5-9-17-25-33-52(31-23-15-7-3-11-19-27-48-35(40)41)39(54)53(32-24-16-8-4-12-20-28-49-36(42)43)34-26-18-10-6-14-22-30-51-38(45)47-2/h3-34H2,1-2H3,(H4,40,41,48)(H4,42,43,49)(H3,44,46,50)(H3,45,47,51) |
| InChIKey | LBEBBJAIKFCPCI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 253.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|