C16H37N11 — CID 176538744
(1E)-1-[amino-[6-(diaminomethylideneamino)hexylamino]methylidene]-2-[6-(diaminomethylideneamino)hexyl]guanidine (PubChem CID 176538744) has the molecular formula C16H37N11 and a molecular weight of 383.55 g/mol. Its IUPAC name is (1E)-1-[amino-[6-(diaminomethylideneamino)hexylamino]methylidene]-2-[6-(diaminomethylideneamino)hexyl]guanidine.
| Compound Name | (1E)-1-[amino-[6-(diaminomethylideneamino)hexylamino]methylidene]-2-[6-(diaminomethylideneamino)hexyl]guanidine |
|---|---|
| PubChem CID | 176538744 |
| Molecular Formula | C16H37N11 |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | (1E)-1-[amino-[6-(diaminomethylideneamino)hexylamino]methylidene]-2-[6-(diaminomethylideneamino)hexyl]guanidine |
| SMILES | NC(N)=NCCCCCC/N=C(N)/N=C(\N)NCCCCCCN=C(N)N |
| InChI | InChI=1S/C16H37N11/c17-13(18)23-9-5-1-3-7-11-25-15(21)27-16(22)26-12-8-4-2-6-10-24-14(19)20/h1-12H2,(H4,17,18,23)(H4,19,20,24)(H5,21,22,25,26,27) |
| InChIKey | RCNDQROBXCUVKW-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 217.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|