C12H22N12 — CID 176525520
(1E)-1-[amino-[6-[[amino-[(E)-[amino-(cyanoamino)methylidene]amino]methylidene]amino]hexylamino]methylidene]-2-isocyanoguanidine (PubChem CID 176525520) has the molecular formula C12H22N12 and a molecular weight of 334.39 g/mol. Its IUPAC name is (1E)-1-[amino-[6-[[amino-[(E)-[amino-(cyanoamino)methylidene]amino]methylidene]amino]hexylamino]methylidene]-2-isocyanoguanidine.
| Compound Name | (1E)-1-[amino-[6-[[amino-[(E)-[amino-(cyanoamino)methylidene]amino]methylidene]amino]hexylamino]methylidene]-2-isocyanoguanidine |
|---|---|
| PubChem CID | 176525520 |
| Molecular Formula | C12H22N12 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1E)-1-[amino-[6-[[amino-[(E)-[amino-(cyanoamino)methylidene]amino]methylidene]amino]hexylamino]methylidene]-2-isocyanoguanidine |
| SMILES | [C-]#[N+]/N=C(N)/N=C(\N)NCCCCCC/N=C(N)/N=C(\N)NC#N |
| InChI | InChI=1S/C12H22N12/c1-18-24-12(17)23-10(15)20-7-5-3-2-4-6-19-9(14)22-11(16)21-8-13/h2-7H2,(H5,14,16,19,21,22)(H5,15,17,20,23,24) |
| InChIKey | AHXVPDXNDZWAEZ-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 205.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|