C10H18N8 — CID 176517039
1-[6-[[amino-(cyanoamino)methylidene]amino]hexyl]-2-cyanoguanidine (PubChem CID 176517039) has the molecular formula C10H18N8 and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-[6-[[amino-(cyanoamino)methylidene]amino]hexyl]-2-cyanoguanidine.
| Compound Name | 1-[6-[[amino-(cyanoamino)methylidene]amino]hexyl]-2-cyanoguanidine |
|---|---|
| PubChem CID | 176517039 |
| Molecular Formula | C10H18N8 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[6-[[amino-(cyanoamino)methylidene]amino]hexyl]-2-cyanoguanidine |
| SMILES | N#C/N=C(\N)NCCCCCC/N=C(\N)NC#N |
| InChI | InChI=1S/C10H18N8/c11-7-17-9(13)15-5-3-1-2-4-6-16-10(14)18-8-12/h1-6H2,(H3,13,15,17)(H3,14,16,18) |
| InChIKey | YXZZOMVBHPCKMM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|