C20H37N7 — CID 176517604
1-[6-[6-[[amino-(prop-2-ynylamino)methylidene]amino]hexylamino]hexyl]-2-prop-2-ynylguanidine (PubChem CID 176517604) has the molecular formula C20H37N7 and a molecular weight of 375.57 g/mol. Its IUPAC name is 1-[6-[6-[[amino-(prop-2-ynylamino)methylidene]amino]hexylamino]hexyl]-2-prop-2-ynylguanidine.
| Compound Name | 1-[6-[6-[[amino-(prop-2-ynylamino)methylidene]amino]hexylamino]hexyl]-2-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 176517604 |
| Molecular Formula | C20H37N7 |
| Molecular Weight | 375.57 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | 1-[6-[6-[[amino-(prop-2-ynylamino)methylidene]amino]hexylamino]hexyl]-2-prop-2-ynylguanidine |
| SMILES | C#CC/N=C(\N)NCCCCCCNCCCCCC/N=C(\N)NCC#C |
| InChI | InChI=1S/C20H37N7/c1-3-13-24-19(21)26-17-11-7-5-9-15-23-16-10-6-8-12-18-27-20(22)25-14-4-2/h1-2,23H,5-18H2,(H3,21,24,26)(H3,22,25,27) |
| InChIKey | OZKIUNAFEPXMSK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.57 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|