C22H47N7 — CID 46845149
2-[8-[8-(diaminomethylideneamino)octylamino]octyl]-1-(2-methylprop-1-enyl)guanidine (PubChem CID 46845149) has the molecular formula C22H47N7 and a molecular weight of 409.67 g/mol. Its IUPAC name is 2-[8-[8-(diaminomethylideneamino)octylamino]octyl]-1-(2-methylprop-1-enyl)guanidine.
| Compound Name | 2-[8-[8-(diaminomethylideneamino)octylamino]octyl]-1-(2-methylprop-1-enyl)guanidine |
|---|---|
| PubChem CID | 46845149 |
| Molecular Formula | C22H47N7 |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 409.39 |
| IUPAC Name | 2-[8-[8-(diaminomethylideneamino)octylamino]octyl]-1-(2-methylprop-1-enyl)guanidine |
| SMILES | CC(C)=CN/C(N)=N/CCCCCCCCNCCCCCCCCN=C(N)N |
| InChI | InChI=1S/C22H47N7/c1-20(2)19-29-22(25)28-18-14-10-6-4-8-12-16-26-15-11-7-3-5-9-13-17-27-21(23)24/h19,26H,3-18H2,1-2H3,(H4,23,24,27)(H3,25,28,29) |
| InChIKey | URDOUXLPUICVCH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|