C6H19Cl2N7 — CID 56843687
2-[2-[2-(diaminomethylideneamino)ethylamino]ethyl]guanidine;dihydrochloride (PubChem CID 56843687) has the molecular formula C6H19Cl2N7 and a molecular weight of 260.17 g/mol. Its IUPAC name is 2-[2-[2-(diaminomethylideneamino)ethylamino]ethyl]guanidine;dihydrochloride.
| Compound Name | 2-[2-[2-(diaminomethylideneamino)ethylamino]ethyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 56843687 |
| Molecular Formula | C6H19Cl2N7 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[2-[2-(diaminomethylideneamino)ethylamino]ethyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCNCCN=C(N)N |
| InChI | InChI=1S/C6H17N7.2ClH/c7-5(8)12-3-1-11-2-4-13-6(9)10;;/h11H,1-4H2,(H4,7,8,12)(H4,9,10,13);2*1H |
| InChIKey | AEVRMGYWAIGJIX-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|